* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BENZYL-1H-TETRAZOLE-5-THIOL |
CAS: | 33898-72-5 |
English Synonyms: | 1-BENZYL-1H-TETRAZOLE-5-THIOL |
MDL Number.: | MFCD00126071 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)Cn2c(nnn2)S |
InChi: | InChI=1S/C8H8N4S/c13-8-9-10-11-12(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,11,13) |
InChiKey: | InChIKey=KPUKRKAPMFWIBV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.