* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,6,7,8-TETRAHYDRO-IMIDAZO[1,2-A]PYRIDINE |
CAS: | 34167-66-3 |
English Synonyms: | 5,6,7,8-TETRAHYDRO-IMIDAZO[1,2-A]PYRIDINE ; IMIDAZO[1,2-A]PYRIDINE, 5,6,7,8-TETRAHYDRO- |
MDL Number.: | MFCD11849324 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cn2c(n1)CCCC2 |
InChi: | InChI=1S/C7H10N2/c1-2-5-9-6-4-8-7(9)3-1/h4,6H,1-3,5H2 |
InChiKey: | InChIKey=PPRGXYWEHFENBY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.