* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-OXAURACIL |
| CAS: | 34314-63-1 |
| English Synonyms: | 3H-[1,3]OXAZINE-2,6-DIONE ; 3,6-DIHYDRO-2H-1,3-OXAZINE-2,6-DIONE ; 3-OXAURACIL |
| MDL Number.: | MFCD00050409 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1c[nH]c(=O)oc1=O |
| InChi: | InChI=1S/C4H3NO3/c6-3-1-2-5-4(7)8-3/h1-2H,(H,5,7) |
| InChiKey: | InChIKey=WQAIPNTUCFSZRZ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.