* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4'(5')-DIMETHYLDIBENZO-18-CROWN-6 |
CAS: | 34368-73-5 |
English Synonyms: | 4,4'(5')-DIMETHYLDIBENZO-18-CROWN-6 |
MDL Number.: | MFCD00068575 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(c1)OCCOCCOc3ccc(cc3OCCOCCO2)C |
InChi: | InChI=1S/C22H28O6/c1-17-3-5-19-21(15-17)27-13-9-23-8-12-26-20-6-4-18(2)16-22(20)28-14-10-24-7-11-25-19/h3-6,15-16H,7-14H2,1-2H3 |
InChiKey: | InChIKey=WJPLIJDQGXWQST-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.