* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDAZOL-3-AMINE |
| CAS: | 343929-48-6 |
| English Synonyms: | INDAZOL-3-AMINE |
| MDL Number.: | MFCD17010082 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C(N=N2)N |
| InChi: | InChI=1S/C7H7N3/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4,7H,8H2 |
| InChiKey: | InChIKey=SRTBRSCNLJCLPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.