* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1H-PYRROLE-2,5-DIONE, 3-(5,6-DIHYDRO-4H-PYRROLO[3,2,1-IJ]QUINOLIN-1-YL)-4-(1H-INDOL-3-YL)- |
| CAS: | 345261-20-3 |
| English Synonyms: | 1H-PYRROLE-2,5-DIONE, 3-(5,6-DIHYDRO-4H-PYRROLO[3,2,1-IJ]QUINOLIN-1-YL)-4-(1H-INDOL-3-YL)- |
| MDL Number.: | MFCD16876157 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c(c[nH]2)C3=C(C(=O)NC3=O)c4cn5c6c4cccc6CCC5 |
| InChi: | InChI=1S/C23H17N3O2/c27-22-19(16-11-24-18-9-2-1-7-14(16)18)20(23(28)25-22)17-12-26-10-4-6-13-5-3-8-15(17)21(13)26/h1-3,5,7-9,11-12,24H,4,6,10H2,(H,25,27,28) |
| InChiKey: | InChIKey=KHOMTMSVRMPSGP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.