* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DIPHENYLINDOLE |
| CAS: | 3469-20-3 |
| English Synonyms: | 2,3-DIPHENYLINDOLE ; 2,3-DIPHENYL-1H-INDOLE ; LIBRARION L522 |
| MDL Number.: | MFCD00022698 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2c3ccccc3[nH]c2c4ccccc4 |
| InChi: | InChI=1S/C20H15N/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)21-20(19)16-11-5-2-6-12-16/h1-14,21H |
| InChiKey: | InChIKey=GYGKJNGSQQORRG-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.