* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(4-ETHYLPHENYL)UREA |
CAS: | 34773-66-5 |
English Synonyms: | (4-ETHYLPHENYL)UREA ; 1-(4-ETHYLPHENYL)UREA |
MDL Number.: | MFCD00025435 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCc1ccc(cc1)NC(=O)N |
InChi: | InChI=1S/C9H12N2O/c1-2-7-3-5-8(6-4-7)11-9(10)12/h3-6H,2H2,1H3,(H3,10,11,12) |
InChiKey: | InChIKey=PCKCTBMQZSHNNS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.