* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-GLY-PHE-ALA-OH |
CAS: | 3480-80-6 |
English Synonyms: | Z-GLY-PHE-ALA-OH |
MDL Number.: | MFCD00238459 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C22H25N3O6/c1-15(21(28)29)24-20(27)18(12-16-8-4-2-5-9-16)25-19(26)13-23-22(30)31-14-17-10-6-3-7-11-17/h2-11,15,18H,12-14H2,1H3,(H,23,30)(H,24,27)(H,25,26)(H,28,29)/t15-,18-/m0/s1 |
InChiKey: | InChIKey=MNDQKYQXVAVFSW-YJBOKZPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.