* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BROMO-2,2,5-TRIMETHYL-1,3-DIOXANE-4,6-DIONE |
CAS: | 34817-42-0 |
English Synonyms: | 5-BROMO-2,2,5-TRIMETHYL-1,3-DIOXANE-4,6-DIONE |
MDL Number.: | MFCD00006635 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC1(OC(=O)C(C(=O)O1)(C)Br)C |
InChi: | InChI=1S/C7H9BrO4/c1-6(2)11-4(9)7(3,8)5(10)12-6/h1-3H3 |
InChiKey: | InChIKey=XCOQDRFRYIKEMS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.