* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Pyrrolidine, 3-(1-methylethyl)- |
CAS: | 34971-73-8 |
English Synonyms: | PYRROLIDINE, 3-(1-METHYLETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C)C1CNCC1 |
InChi: | InChI=1S/C7H15N/c1-6(2)7-3-4-8-5-7/h6-8H,3-5H2,1-2H3 |
InChiKey: | InChIKey=QFHZPMOJWIBZCS-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.