* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PRO-GLY-NH2 |
CAS: | 35010-96-9 |
English Synonyms: | Z-PRO-GLY-NH2 |
MDL Number.: | MFCD00238503 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)COC(=O)N2CCC[C@H]2C(=O)NCC(=O)N |
InChi: | InChI=1S/C15H19N3O4/c16-13(19)9-17-14(20)12-7-4-8-18(12)15(21)22-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H2,16,19)(H,17,20)/t12-/m0/s1 |
InChiKey: | InChIKey=YQHPZEVGWUTGLC-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.