Molecular Structure:
CAS No.:
35045-72-8
Product Name.:
CCD No.:CCD00071924
Formula:C5 H3 D8 N O2
MolWeight:125.196
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | L-VALINE-D8 |
| CAS： | 35045-72-8 |
| English Synonyms： | L-VALINE-D8 ; L-VALINE-2,3,4,4,4,5,5,5-D8 |
| MDL Number.： | MFCD00144704 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])[C@@]([2H])(C(=O)O)N |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | 295-300 DEG C (SUBL)(LIT) |
| Comments： | MASS SHIFT: M+8 OPTICAL ACTIVITY: [ALPHA]20/D +27.5 DEG, C = 8 IN 6 M HCL UNSPSC: 12142200 WGK: 1 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 125.19 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
