* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-VALINE-D8 |
CAS: | 35045-72-8 |
English Synonyms: | L-VALINE-2,3,4,4,4,5,5,5-D8 ; L-VALINE-D8 |
MDL Number.: | MFCD00144704 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])[C@@]([2H])(C(=O)O)N |
InChiKey: | InChIKey=null |
Property |
|
Melting Point: | 295-300 DEG C (SUBL)(LIT) |
Comments: | MASS SHIFT: M+8 OPTICAL ACTIVITY: [ALPHA]20/D +27.5 DEG, C = 8 IN 6 M HCL UNSPSC: 12142200 WGK: 1 |
Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 125.19 BY ATOM % CALCULATION |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.