* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Butanone, 4-(2-chlorophenyl)- |
CAS: | 3506-72-7 |
English Synonyms: | 2-BUTANONE, 4-(2-CHLOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=C(C=CC=C1)CCC(C)=O |
InChi: | InChI=1S/C10H11ClO/c1-8(12)6-7-9-4-2-3-5-10(9)11/h2-5H,6-7H2,1H3 |
InChiKey: | InChIKey=IODZQCDPJUFKQW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.