* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3,4,5-TETRAFLUOROPYRIDINE |
| CAS: | 3512-16-1 |
| English Synonyms: | PYRIDINE, 2,3,4,5-TETRAFLUORO- ; 2,3,4,5-TETRAFLUOROPYRIDINE |
| MDL Number.: | MFCD03788727 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1c(c(c(c(n1)F)F)F)F |
| InChi: | InChI=1S/C5HF4N/c6-2-1-10-5(9)4(8)3(2)7/h1H |
| InChiKey: | InChIKey=MVRNAPZMQQYTIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.