* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-([2,2']BITHIEN-5-YL)ACRYLIC ACID |
CAS: | 3515-26-2 |
English Synonyms: | 3-([2,2']BITHIEN-5-YL)ACRYLIC ACID |
MDL Number.: | MFCD00098466 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1)c2ccc(s2)/C=C/C(=O)O |
InChi: | InChI=1S/C11H8O2S2/c12-11(13)6-4-8-3-5-10(15-8)9-2-1-7-14-9/h1-7H,(H,12,13)/b6-4+ |
InChiKey: | InChIKey=HWUXLEJHIBZOHB-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.