* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIHYDRO-9,10[1',2']-BENZENOANTHRACENE-1,4-DIONE |
CAS: | 3519-82-2 |
English Synonyms: | INCA-6 ; NFAT ACTIVATION INHIBITOR III ; RARECHEM AQ BC 8A40 ; 9,10-DIHYDRO-9,10[1',2']-BENZENOANTHRACENE-1,4-DIONE ; PENTACYCLO[6.6.6.0(2,7).0(9,14).0(15,20)]ICOSA-2(7),4,9,11,13,15,17,19-OCTAENE-3,6-DIONE |
MDL Number.: | MFCD00226933 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)[C@H]3c4ccccc4[C@@H]2C5=C3C(=O)C=CC5=O |
InChi: | InChI=1S/C20H12O2/c21-15-9-10-16(22)20-18-12-6-2-1-5-11(12)17(19(15)20)13-7-3-4-8-14(13)18/h1-10,17-18H/t17-,18+ |
InChiKey: | InChIKey=GCHPUOHXXCNSQL-HDICACEKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.