* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(4-PYRIDINYL)-3-AZASPIRO[5.5]UNDECAN-9-ONE |
CAS: | 352348-19-7 |
English Synonyms: | 3-(4-PYRIDINYL)-3-AZASPIRO[5.5]UNDECAN-9-ONE ; 3-AZASPIRO[5.5]UNDECAN-9-ONE, 3-(4-PYRIDINYL)- |
MDL Number.: | MFCD17013075 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cnccc1N2CCC3(CCC(=O)CC3)CC2 |
InChi: | InChI=1S/C15H20N2O/c18-14-1-5-15(6-2-14)7-11-17(12-8-15)13-3-9-16-10-4-13/h3-4,9-10H,1-2,5-8,11-12H2 |
InChiKey: | InChIKey=HLHHXJZDFVOAAB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.