* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BENZENEPROPANOL, B,4-DIAMINO-, (R)- |
CAS: | 352525-34-9 |
English Synonyms: | BENZENEPROPANOL, B,4-DIAMINO-, (R)- |
MDL Number.: | MFCD17214641 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(ccc1C[C@H](CO)N)N |
InChi: | InChI=1S/C9H14N2O/c10-8-3-1-7(2-4-8)5-9(11)6-12/h1-4,9,12H,5-6,10-11H2/t9-/m1/s1 |
InChiKey: | InChIKey=GMTRSZXBNADBMK-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.