* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-NITRO-3,4-XYLYL DISELENIDE |
CAS: | 35350-44-8 |
English Synonyms: | 6-NITRO-3,4-XYLYL DISELENIDE |
MDL Number.: | MFCD00087860 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cc1cc(c(cc1C)[Se][Se]c2cc(c(cc2[N+](=O)[O-])C)C)[N+](=O)[O-] |
InChi: | InChI=1S/C16H16N2O4Se2/c1-9-5-13(17(19)20)15(7-11(9)3)23-24-16-8-12(4)10(2)6-14(16)18(21)22/h5-8H,1-4H3 |
InChiKey: | InChIKey=VCGJYIWNJPIBDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.