* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDINE, 2-NITRO-, HYDRATE |
| CAS: | 354527-54-1 |
| English Synonyms: | PYRIDINE, 2-NITRO-, HYDRATE |
| MDL Number.: | MFCD13175444 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccnc(c1)[N+](=O)[O-].O |
| InChi: | InChI=1S/C5H4N2O2.H2O/c8-7(9)5-3-1-2-4-6-5;/h1-4H;1H2 |
| InChiKey: | InChIKey=KQZNIBDRFBZVTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.