* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHIDIUM |
| CAS: | 3546-21-2 |
| English Synonyms: | ETHIDIUM |
| MDL Number.: | MFCD01708606 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC[n+]1c2cc(ccc2c3ccc(cc3c1c4ccccc4)N)N |
| InChi: | InChI=1S/C21H19N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,23H,2,22H2,1H3/p+1 |
| InChiKey: | InChIKey=QTANTQQOYSUMLC-UHFFFAOYSA-O |
* If the product has intellectual property rights, a license granted is must or contact us.