* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-Alanine, 3-sulfo- |
CAS: | 35554-98-4 |
English Synonyms: | D-ALANINE, 3-SULFO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | S(=O)(=O)(O)C[C@@H](N)C(=O)O |
InChi: | InChI=1S/C3H7NO5S/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/t2-/m1/s1 |
InChiKey: | InChIKey=XVOYSCVBGLVSOL-UWTATZPHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.