* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | NEUTRAL VIOLET |
CAS: | 3562-46-7 |
English Synonyms: | NEUTRAL VIOLET |
MDL Number.: | MFCD00050592 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CN(C)c1ccc(cc1)Nc2cc3c(cc2N)nc4cc(ccc4n3)N(C)C.Cl |
InChi: | InChI=1S/C22H24N6.ClH/c1-27(2)15-7-5-14(6-8-15)24-19-13-22-21(12-17(19)23)26-20-11-16(28(3)4)9-10-18(20)25-22;/h5-13,24H,23H2,1-4H3;1H |
InChiKey: | InChIKey=USDDHXNRSWIAES-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.