* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-METHOXYPHENYL)-4H-3,1-BENZOXAZIN-4-ONE |
CAS: | 35673-24-6 |
English Synonyms: | 2-(3-METHOXYPHENYL)-4H-3,1-BENZOXAZIN-4-ONE |
MDL Number.: | MFCD00024118 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1cccc(c1)c2nc3ccccc3c(=O)o2 |
InChi: | InChI=1S/C15H11NO3/c1-18-11-6-4-5-10(9-11)14-16-13-8-3-2-7-12(13)15(17)19-14/h2-9H,1H3 |
InChiKey: | InChIKey=DVJLPHFMBUSVQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.