* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ALBASPIDIN AA |
CAS: | 3570-40-9 |
English Synonyms: | ALBASPIDIN AA |
MDL Number.: | MFCD20274935 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC(=O)C1=C(C(C(=C(C1=O)CC2=C(C(C(=C(C2=O)C(=O)C)O)(C)C)O)O)(C)C)O |
InChi: | InChI=1S/C21H24O8/c1-8(22)12-14(24)10(16(26)20(3,4)18(12)28)7-11-15(25)13(9(2)23)19(29)21(5,6)17(11)27/h26-29H,7H2,1-6H3 |
InChiKey: | InChIKey=ZNHQGDRCJLCCSS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.