* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CYNAROPICRIN |
CAS: | 35730-78-0 |
English Synonyms: | CYNAROPICRIN |
MDL Number.: | MFCD09752784 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C/C(=C\O)/C(=O)O[C@H]1CC(=C)[C@@H]2C[C@@H](C(=C)[C@@H]2[C@@H]3[C@@H]1C(=C)C(=O)O3)O |
InChi: | InChI=1S/C19H22O6/c1-8-5-14(24-18(22)9(2)7-20)16-11(4)19(23)25-17(16)15-10(3)13(21)6-12(8)15/h7,12-17,20-21H,1,3-6H2,2H3/b9-7+/t12-,13-,14-,15-,16+,17+/m0/s1 |
InChiKey: | InChIKey=LBPSRWRTOWEBRQ-XVSULKNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.