* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FLUOTRACEN |
| CAS: | 35764-73-9 |
| English Synonyms: | FLUOTRACEN |
| MDL Number.: | MFCD00866703 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC1c2ccccc2C(c3c1ccc(c3)C(F)(F)F)CCCN(C)C |
| InChi: | InChI=1S/C21H24F3N/c1-14-16-7-4-5-8-18(16)19(9-6-12-25(2)3)20-13-15(21(22,23)24)10-11-17(14)20/h4-5,7-8,10-11,13-14,19H,6,9,12H2,1-3H3 |
| InChiKey: | InChIKey=JTAJFHGSVCEPKC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.