* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-IODO-2H,2H, 4H,4H-NONAFLUOROHEXANE |
CAS: | 358-24-7 |
English Synonyms: | 1-IODO-2H,2H, 4H,4H-NONAFLUOROHEXANE |
MDL Number.: | MFCD17214417 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C(CC(F)(F)I)(F)F)C(C(F)(F)F)(F)F |
InChi: | InChI=1S/C6H4F9I/c7-3(8,2-5(11,12)16)1-4(9,10)6(13,14)15/h1-2H2 |
InChiKey: | InChIKey=ITBHNTRNIVAZDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.