* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 17A-PREGN-5-EN-20-YNE-3B,17-DIOL |
CAS: | 3604-60-2 |
English Synonyms: | 17A-PREGN-5-EN-20-YNE-3B,17-DIOL ; 17ALPHA-PREGN-5-EN-20-YNE-3BETA,17-DIOL |
MDL Number.: | MFCD00083066 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(C#C)O)C)O |
InChi: | InChI=1S/C21H30O2/c1-4-21(23)12-9-18-16-6-5-14-13-15(22)7-10-19(14,2)17(16)8-11-20(18,21)3/h1,5,15-18,22-23H,6-13H2,2-3H3/t15-,16+,17-,18-,19-,20-,21+/m0/s1 |
InChiKey: | InChIKey=VGJUOWGYQZYCII-GCOKGBOCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.