* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-IODOAZULENE |
| CAS: | 36044-41-4 |
| English Synonyms: | 2-IODOAZULENE |
| MDL Number.: | MFCD16877128 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | c1ccc-2cc(cc2cc1)I |
| InChi: | InChI=1S/C10H7I/c11-10-6-8-4-2-1-3-5-9(8)7-10/h1-7H |
| InChiKey: | InChIKey=XASHWDKOJUHIRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.