* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IREHDIAMINE A |
CAS: | 3614-57-1 |
English Synonyms: | IREHDIAMINE A |
MDL Number.: | MFCD01698900 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2CC=C4[C@@]3(CC[C@@H](C4)N)C)C)N |
InChi: | InChI=1S/C21H36N2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,13,15-19H,5-12,22-23H2,1-3H3/t13-,15-,16?,17+,18-,19-,20-,21+/m0/s1 |
InChiKey: | InChIKey=XDELLWIDOQOKHV-QVIAMJNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.