* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-GLU-OH |
CAS: | 3617-46-7 |
English Synonyms: | Z-PHE-GLU-OH |
MDL Number.: | MFCD00238495 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C22H25N3O6/c23-20(28)17(11-12-19(26)27)24-21(29)18(13-15-7-3-1-4-8-15)25-22(30)31-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H2,23,28)(H,24,29)(H,25,30)(H,26,27)/t17-,18-/m0/s1 |
InChiKey: | InChIKey=YIXZSXBKXSEXLM-ROUUACIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.