Molecular Structure:
CAS No.:
36289-42-6
Product Name.:
CCD No.:CCD00163332
Formula:C5 H6 N2 O2 S3
MolWeight:222.312
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | ETHYL N-(3-THIOXO-3H-1,2,4-DITHIAZOL-5-YL)CARBAMATE |
| CAS： | 36289-42-6 |
| English Synonyms： | ETHYL N-(3-THIOXO-3H-1,2,4-DITHIAZOL-5-YL)CARBAMATE |
| MDL Number.： | MFCD00793644 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCOC(=O)Nc1nc(=S)ss1 |
| InChi： | InChI=1S/C5H6N2O2S3/c1-2-9-4(8)6-3-7-5(10)12-11-3/h2H2,1H3,(H,6,7,8,10) |
| InChiKey： | InChIKey=UEMCBOFMAWFDPF-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
