* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KETAZOCINE |
| CAS: | 36292-69-0 |
| English Synonyms: | KETAZOCINE |
| MDL Number.: | MFCD00864306 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C[C@H]1[C@H]2C(=O)c3ccc(cc3[C@@]1(CCN2CC4CC4)C)O |
| InChi: | InChI=1S/C18H23NO2/c1-11-16-17(21)14-6-5-13(20)9-15(14)18(11,2)7-8-19(16)10-12-3-4-12/h5-6,9,11-12,16,20H,3-4,7-8,10H2,1-2H3/t11-,16-,18+/m0/s1 |
| InChiKey: | InChIKey=HQBZLVPZOGIAIQ-SDDDUWNISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.