* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-OXONONANOIC ACID |
CAS: | 3637-15-8 |
English Synonyms: | 5-OXONONANOIC ACID |
MDL Number.: | MFCD01320162 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCC(=O)CCCC(=O)O |
InChi: | InChI=1S/C9H16O3/c1-2-3-5-8(10)6-4-7-9(11)12/h2-7H2,1H3,(H,11,12) |
InChiKey: | InChIKey=IOLZRTYKQAFXFB-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.