* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GEIPARVARIN |
| CAS: | 36413-91-9 |
| English Synonyms: | GEIPARVARIN |
| MDL Number.: | MFCD00075895 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | C/C(=C/COc1ccc2ccc(=O)oc2c1)/C3=CC(=O)C(O3)(C)C |
| InChi: | InChI=1S/C19H18O5/c1-12(15-11-17(20)19(2,3)24-15)8-9-22-14-6-4-13-5-7-18(21)23-16(13)10-14/h4-8,10-11H,9H2,1-3H3/b12-8- |
| InChiKey: | InChIKey=OUTLLBZGJYDUQE-WQLSENKSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.