* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHYL-5-PYRIDIN-4-YL-4H-[1,2,4]TRIAZOLE-3-THIOL |
| CAS: | 3652-32-2 |
| English Synonyms: | 4-METHYL-5-(4-PYRIDYL)-4H-1,2,4-TRIAZOLE-3-THIOL ; BUTTPARK 25\07-10 ; 4-METHYL-5-PYRIDIN-4-YL-4H-[1,2,4]TRIAZOLE-3-THIOL ; ZERENEX E/1009888 ; 4-METHYL-5-(PYRID-4-YL)-4H-1,2,4-TRIAZOLE-3-THIOL ; 4-METHYL-5-(4-PYRIDYL)-1,2,4-TRIAZOLE-3-THIOL |
| MDL Number.: | MFCD00112607 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cn1c(nnc1S)c2ccncc2 |
| InChi: | InChI=1S/C8H8N4S/c1-12-7(10-11-8(12)13)6-2-4-9-5-3-6/h2-5H,1H3,(H,11,13) |
| InChiKey: | InChIKey=ACDUEIIMRXEFHO-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.