* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-AMINO-4H-1,2,4-TRIAZOLE-3,5-DITHIOL |
CAS: | 3652-33-3 |
English Synonyms: | 4-AMINO-1,2,4-TRIAZOLE-3,5-DITHIOL ; 4-AMINO-4H-1,2,4-TRIAZOLE-3,5-DITHIOL |
MDL Number.: | MFCD00101075 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1(nnc(n1N)S)S |
InChi: | InChI=1S/C2H4N4S2/c3-6-1(7)4-5-2(6)8/h3H2,(H,4,7)(H,5,8) |
InChiKey: | InChIKey=MFLTWZOFWVXIEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.