* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (1R,2R,3S,4R)-3-AMINOBICYCLO[2.2.1]HEPTANE-2-CARBOXAMIDE |
| CAS: | 365544-17-8 |
| English Synonyms: | (1R,2R,3S,4R)-3-AMINOBICYCLO[2.2.1]HEPTANE-2-CARBOXAMIDE ; BICYCLO[2.2.1]HEPTANE-2-CARBOXAMIDE, 3-AMINO-, (1S,2R,3S,4R)- |
| MDL Number.: | MFCD18834608 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1C[C@@H]2C[C@@H]1[C@H]([C@H]2N)C(=O)N |
| InChi: | InChI=1S/C8H14N2O/c9-7-5-2-1-4(3-5)6(7)8(10)11/h4-7H,1-3,9H2,(H2,10,11)/t4-,5-,6-,7+/m1/s1 |
| InChiKey: | InChIKey=VDCVNVOMIJJJJO-GBNDHIKLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.