* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-OXO-15S-HYDROXY-PROSTA-5Z,8(12),13E,17Z-TETRAEN-1-OIC ACID |
CAS: | 36614-32-1 |
English Synonyms: | 9-OXO-15S-HYDROXY-PROSTA-5Z,8(12),13E,17Z-TETRAEN-1-OIC ACID ; PROSTAGLANDIN B3 |
MDL Number.: | MFCD00797637 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC/C=C\C[C@@H](/C=C/C1=C(C(=O)CC1)C/C=C\CCCC(=O)O)O |
InChi: | InChI=1S/C20H28O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h3-4,6-7,12,14,17,21H,2,5,8-11,13,15H2,1H3,(H,23,24)/b6-3-,7-4-,14-12+/t17-/m0/s1 |
InChiKey: | InChIKey=DQRGQQAJYRBDRP-UNBCGXALSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.