Molecular Structure:
CAS No.:
3670-93-7
Product Name.:
CCD No.:CCD00092540
Formula:C5 H8 O6 S2
MolWeight:228.244
![2,4,8,10-TETRAOXA-3,9-DITHIASPIRO[5.5]UNDECANE 3,9-DIOXIDE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 2,4,8,10-TETRAOXA-3,9-DITHIASPIRO[5.5]UNDECANE 3,9-DIOXIDE |
| CAS： | 3670-93-7 |
| English Synonyms： | 2,4,8,10-TETRAOXA-3,9-DITHIASPIRO[5.5]UNDECANE 3,9-DIOXIDE |
| MDL Number.： | MFCD00196615 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | C1C2(COS(=O)O1)COS(=O)OC2 |
| InChi： | InChI=1S/C5H8O6S2/c6-12-8-1-5(2-9-12)3-10-13(7)11-4-5/h1-4H2 |
| InChiKey： | InChIKey=UCFQFMBCPHTKRN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
