* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-D-ALA-OH |
CAS: | 3695-80-5 |
English Synonyms: | H-ALA-D-ALA-OH ; ALA-D-ALA-OH ; L-ALANYL-D-ALANINE |
MDL Number.: | MFCD00066040 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C[C@@H](C(=O)N[C@H](C)C(=O)O)N |
InChi: | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4+/m0/s1 |
InChiKey: | InChIKey=DEFJQIDDEAULHB-IUYQGCFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.