* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLICARAMIDE |
| CAS: | 36980-34-4 |
| English Synonyms: | GLICARAMIDE |
| MDL Number.: | MFCD00865501 |
| H bond acceptor: | 11 |
| H bond donor: | 3 |
| Smile: | CCn1c2c(c(n1)C)c(c(cn2)C(=O)NCCc3ccc(cc3)S(=O)(=O)NC(=O)NC4CCCCC4)OCCC(C)C |
| InChi: | InChI=1S/C30H42N6O5S/c1-5-36-28-26(21(4)34-36)27(41-18-16-20(2)3)25(19-32-28)29(37)31-17-15-22-11-13-24(14-12-22)42(39,40)35-30(38)33-23-9-7-6-8-10-23/h11-14,19-20,23H,5-10,15-18H2,1-4H3,(H,31,37)(H2,33,35,38) |
| InChiKey: | InChIKey=DIBGLVNSPMMGHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.