* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ACTODIGIN |
| CAS: | 36983-69-4 |
| English Synonyms: | ACTODIGIN |
| MDL Number.: | MFCD00867119 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@@]3(CC[C@@H]4C5=CCOC5=O)O)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
| InChi: | InChI=1S/C29H44O9/c1-27-9-5-16(37-26-24(33)23(32)22(31)21(14-30)38-26)13-15(27)3-4-20-19(27)6-10-28(2)18(7-11-29(20,28)35)17-8-12-36-25(17)34/h8,15-16,18-24,26,30-33,35H,3-7,9-14H2,1-2H3/t15-,16+,18-,19+,20-,21-,22-,23+,24-,26-,27+,28-,29+/m1/s1 |
| InChiKey: | InChIKey=ACLJAFRNPZVVIW-ADFGDECNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.