* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-METHYL-1,2,4-THIADIAZOLE-5(4H)-THIONE |
CAS: | 36988-21-3 |
English Synonyms: | 3-METHYL-1,2,4-THIADIAZOLE-5(4H)-THIONE |
MDL Number.: | MFCD16877741 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1[nH]c(=S)sn1 |
InChi: | InChI=1S/C3H4N2S2/c1-2-4-3(6)7-5-2/h1H3,(H,4,5,6) |
InChiKey: | InChIKey=QPHZWABVAIGWHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.