* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-O-METHYLTHYMIDINE |
CAS: | 37085-48-6 |
English Synonyms: | 2-O-METHYLTHYMIDINE |
MDL Number.: | MFCD00057924 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1cn(c(nc1=O)OC)[C@H]2C[C@@H]([C@H](O2)CO)O |
InChi: | InChI=1S/C11H16N2O5/c1-6-4-13(11(17-2)12-10(6)16)9-3-7(15)8(5-14)18-9/h4,7-9,14-15H,3,5H2,1-2H3/t7-,8+,9+/m0/s1 |
InChiKey: | InChIKey=OVADECQWSOWNFN-DJLDLDEBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.