Molecular Structure:
CAS No.:
3714-18-9
Product Name.:
CCD No.:CCD00089634
Formula:C6 H12 O6
MolWeight:184.133
![GLUCOSE D[3,4-14C] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | GLUCOSE D[3,4-14C] |
| CAS： | 3714-18-9 |
| English Synonyms： | GLUCOSE D[3,4-14C] |
| MDL Number.： | MFCD00189744 |
| H bond acceptor： | 6 |
| H bond donor： | 5 |
| Smile： | C([C@H]([14C@H]([14C@@H]([C@H](C=O)O)O)O)O)O |
| InChi： | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i5+2,6+2 |
| InChiKey： | InChIKey=GZCGUPFRVQAUEE-IEHSSVHYSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
