* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2R,3R)-(+)-2,3-EPOXY-3-(4-NITROPHENYL)-1-PROPANOL |
CAS: | 37141-32-5 |
English Synonyms: | TRANS-(+)-2,3-EPOXY-3-(P-NITROPHENYL)-1-PROPANOL ; (2R,3R)-(+)-3-(4-NITROPHENYL)GLYCIDOL ; (2R,3R)-(+)-2,3-EPOXY-3-(4-NITROPHENYL)-1-PROPANOL |
MDL Number.: | MFCD00070221 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1[C@@H]2[C@H](O2)CO)[N+](=O)[O-] |
InChi: | InChI=1S/C9H9NO4/c11-5-8-9(14-8)6-1-3-7(4-2-6)10(12)13/h1-4,8-9,11H,5H2/t8-,9-/m1/s1 |
InChiKey: | InChIKey=TVWSYFXHQPGITR-RKDXNWHRSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.