* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | DIHYDROAMBRATE |
CAS: | 37172-02-4 |
English Synonyms: | DIHYDROAMBRATE |
MDL Number.: | MFCD00072176 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(C)C1CCCCC1(C=C)OC(=O)C |
InChi: | InChI=1S/C14H24O2/c1-5-11(3)13-9-7-8-10-14(13,6-2)16-12(4)15/h6,11,13H,2,5,7-10H2,1,3-4H3 |
InChiKey: | InChIKey=KOSQMCNVEGXSCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.